C16H20N8O3 — CID 4055851
N-[(5-nitrofuran-2-yl)methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 4055851) has the molecular formula C16H20N8O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is N-[(5-nitrofuran-2-yl)methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(5-nitrofuran-2-yl)methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 4055851 |
| Molecular Formula | C16H20N8O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[(5-nitrofuran-2-yl)methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(C=NNc2nc(N3CCCC3)nc(N3CCCC3)n2)o1 |
| InChI | InChI=1S/C16H20N8O3/c25-24(26)13-6-5-12(27-13)11-17-21-14-18-15(22-7-1-2-8-22)20-16(19-14)23-9-3-4-10-23/h5-6,11H,1-4,7-10H2,(H,18,19,20,21) |
| InChIKey | SKUFHMTWCCQOFP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|