C18H22N8O4 — CID 135479235
2-[(E)-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol (PubChem CID 135479235) has the molecular formula C18H22N8O4 and a molecular weight of 414.43 g/mol. Its IUPAC name is 2-[(E)-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol.
| Compound Name | 2-[(E)-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 135479235 |
| Molecular Formula | C18H22N8O4 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-[(E)-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol |
| SMILES | O=[N+]([O-])c1cccc(/C=N/Nc2nc(N3CCCC3)nc(N3CCOCC3)n2)c1O |
| InChI | InChI=1S/C18H22N8O4/c27-15-13(4-3-5-14(15)26(28)29)12-19-23-16-20-17(24-6-1-2-7-24)22-18(21-16)25-8-10-30-11-9-25/h3-5,12,27H,1-2,6-11H2,(H,20,21,22,23)/b19-12+ |
| InChIKey | TUXQJCBHQRLPGA-XDHOZWIPSA-N |
| XLogP | 1.37 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|