C22H23FN8O6 — CID 136611918
acetic acid;2-[(E)-[[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol (PubChem CID 136611918) has the molecular formula C22H23FN8O6 and a molecular weight of 514.47 g/mol. Its IUPAC name is acetic acid;2-[(E)-[[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol.
| Compound Name | acetic acid;2-[(E)-[[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 136611918 |
| Molecular Formula | C22H23FN8O6 |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | acetic acid;2-[(E)-[[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol |
| SMILES | CC(=O)O.O=[N+]([O-])c1cccc(/C=N/Nc2nc(Nc3ccc(F)cc3)nc(N3CCOCC3)n2)c1O |
| InChI | InChI=1S/C20H19FN8O4.C2H4O2/c21-14-4-6-15(7-5-14)23-18-24-19(26-20(25-18)28-8-10-33-11-9-28)27-22-12-13-2-1-3-16(17(13)30)29(31)32;1-2(3)4/h1-7,12,30H,8-11H2,(H2,23,24,25,26,27);1H3,(H,3,4)/b22-12+; |
| InChIKey | OWHRDSLWXRZJAT-RSRKELGKSA-N |
| XLogP | 2.74 |
| TPSA | 188.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|