C21H22N8O4 — CID 135906066
2-[(Z)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol (PubChem CID 135906066) has the molecular formula C21H22N8O4 and a molecular weight of 450.46 g/mol. Its IUPAC name is 2-[(Z)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol.
| Compound Name | 2-[(Z)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 135906066 |
| Molecular Formula | C21H22N8O4 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[(Z)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol |
| SMILES | O=[N+]([O-])c1cccc(/C=N\Nc2nc(NCc3ccccc3)nc(N3CCOCC3)n2)c1O |
| InChI | InChI=1S/C21H22N8O4/c30-18-16(7-4-8-17(18)29(31)32)14-23-27-20-24-19(22-13-15-5-2-1-3-6-15)25-21(26-20)28-9-11-33-12-10-28/h1-8,14,30H,9-13H2,(H2,22,24,25,26,27)/b23-14- |
| InChIKey | SFTBQTIUODSOKR-UCQKPKSFSA-N |
| XLogP | 2.38 |
| TPSA | 150.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|