C21H21I2N7O2 — CID 135509019
2-[(E)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol (PubChem CID 135509019) has the molecular formula C21H21I2N7O2 and a molecular weight of 657.25 g/mol. Its IUPAC name is 2-[(E)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol.
| Compound Name | 2-[(E)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 135509019 |
| Molecular Formula | C21H21I2N7O2 |
| Molecular Weight | 657.25 g/mol |
| Exact Mass | 656.98 |
| IUPAC Name | 2-[(E)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol |
| SMILES | Oc1c(I)cc(I)cc1/C=N/Nc1nc(NCc2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H21I2N7O2/c22-16-10-15(18(31)17(23)11-16)13-25-29-20-26-19(24-12-14-4-2-1-3-5-14)27-21(28-20)30-6-8-32-9-7-30/h1-5,10-11,13,31H,6-9,12H2,(H2,24,26,27,28,29)/b25-13+ |
| InChIKey | OOVWFGIDAYBMCU-DHRITJCHSA-N |
| XLogP | 3.68 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|