C20H19I2N7O2 — CID 136772678
2-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4,6-diiodophenol (PubChem CID 136772678) has the molecular formula C20H19I2N7O2 and a molecular weight of 643.23 g/mol. Its IUPAC name is 2-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4,6-diiodophenol.
| Compound Name | 2-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 136772678 |
| Molecular Formula | C20H19I2N7O2 |
| Molecular Weight | 643.23 g/mol |
| Exact Mass | 642.97 |
| IUPAC Name | 2-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4,6-diiodophenol |
| SMILES | Oc1c(I)cc(I)cc1/C=N\Nc1nc(Nc2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H19I2N7O2/c21-14-10-13(17(30)16(22)11-14)12-23-28-19-25-18(24-15-4-2-1-3-5-15)26-20(27-19)29-6-8-31-9-7-29/h1-5,10-12,30H,6-9H2,(H2,24,25,26,27,28)/b23-12- |
| InChIKey | ZTQBURYMZOHTMG-FMCGGJTJSA-N |
| XLogP | 3.81 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|