C22H22I2N8O3 — CID 136717885
2-[(Z)-[[4-(azepan-1-yl)-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol (PubChem CID 136717885) has the molecular formula C22H22I2N8O3 and a molecular weight of 700.28 g/mol. Its IUPAC name is 2-[(Z)-[[4-(azepan-1-yl)-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol.
| Compound Name | 2-[(Z)-[[4-(azepan-1-yl)-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 136717885 |
| Molecular Formula | C22H22I2N8O3 |
| Molecular Weight | 700.28 g/mol |
| Exact Mass | 699.99 |
| IUPAC Name | 2-[(Z)-[[4-(azepan-1-yl)-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(N/N=C\c3cc(I)cc(I)c3O)nc(N3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C22H22I2N8O3/c23-15-11-14(19(33)18(24)12-15)13-25-30-21-27-20(26-16-5-7-17(8-6-16)32(34)35)28-22(29-21)31-9-3-1-2-4-10-31/h5-8,11-13,33H,1-4,9-10H2,(H2,26,27,28,29,30)/b25-13- |
| InChIKey | KZKOOPCGOYQMNG-MXAYSNPKSA-N |
| XLogP | 5.26 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.28 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|