C22H23ClN8O2 — CID 4030930
6-(azepan-1-yl)-2-N-[(4-chlorophenyl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 4030930) has the molecular formula C22H23ClN8O2 and a molecular weight of 466.93 g/mol. Its IUPAC name is 6-(azepan-1-yl)-2-N-[(4-chlorophenyl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(azepan-1-yl)-2-N-[(4-chlorophenyl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 4030930 |
| Molecular Formula | C22H23ClN8O2 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 6-(azepan-1-yl)-2-N-[(4-chlorophenyl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(NN=Cc3ccc(Cl)cc3)nc(N3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C22H23ClN8O2/c23-17-7-5-16(6-8-17)15-24-29-21-26-20(25-18-9-11-19(12-10-18)31(32)33)27-22(28-21)30-13-3-1-2-4-14-30/h5-12,15H,1-4,13-14H2,(H2,25,26,27,28,29) |
| InChIKey | HAFPYKBDCRJSSB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|