C26H23ClN8O2S — CID 3256453
2-N-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 3256453) has the molecular formula C26H23ClN8O2S and a molecular weight of 547.04 g/mol. Its IUPAC name is 2-N-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3256453 |
| Molecular Formula | C26H23ClN8O2S |
| Molecular Weight | 547.04 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 2-N-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cc(C=NNc2nc(Nc3ccccc3)nc(N3CCCC3)n2)ccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H23ClN8O2S/c27-19-9-11-21(12-10-19)38-23-13-8-18(16-22(23)35(36)37)17-28-33-25-30-24(29-20-6-2-1-3-7-20)31-26(32-25)34-14-4-5-15-34/h1-3,6-13,16-17H,4-5,14-15H2,(H2,29,30,31,32,33) |
| InChIKey | NLVCYUZVDYPDAN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.04 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|