C21H18ClFN6O3S — CID 4217862
N-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 4217862) has the molecular formula C21H18ClFN6O3S and a molecular weight of 488.93 g/mol. Its IUPAC name is N-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 4217862 |
| Molecular Formula | C21H18ClFN6O3S |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | N-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1cc(C=NNc2ncc(F)c(N3CCOCC3)n2)ccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClFN6O3S/c22-15-2-4-16(5-3-15)33-19-6-1-14(11-18(19)29(30)31)12-25-27-21-24-13-17(23)20(26-21)28-7-9-32-10-8-28/h1-6,11-13H,7-10H2,(H,24,26,27) |
| InChIKey | CXPWMJNVPLKYEK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|