C25H28N8O2S — CID 39378688
N-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 39378688) has the molecular formula C25H28N8O2S and a molecular weight of 504.62 g/mol. Its IUPAC name is N-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 39378688 |
| Molecular Formula | C25H28N8O2S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | N-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(Sc2ccc(/C=N/Nc3nc(N4CCCC4)nc(N4CCCC4)n3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H28N8O2S/c1-18-6-9-20(10-7-18)36-22-11-8-19(16-21(22)33(34)35)17-26-30-23-27-24(31-12-2-3-13-31)29-25(28-23)32-14-4-5-15-32/h6-11,16-17H,2-5,12-15H2,1H3,(H,27,28,29,30)/b26-17+ |
| InChIKey | UJVVUXKVPPFIDJ-YZSQISJMSA-N |
| XLogP | 4.89 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|