C21H18N4O3S — CID 39378537
1-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3-phenylurea (PubChem CID 39378537) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is 1-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3-phenylurea.
| Compound Name | 1-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 39378537 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-[(E)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3-phenylurea |
| SMILES | Cc1ccc(Sc2ccc(/C=N/NC(=O)Nc3ccccc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18N4O3S/c1-15-7-10-18(11-8-15)29-20-12-9-16(13-19(20)25(27)28)14-22-24-21(26)23-17-5-3-2-4-6-17/h2-14H,1H3,(H2,23,24,26)/b22-14+ |
| InChIKey | LKCDVROBXNNONI-HYARGMPZSA-N |
| XLogP | 5.21 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|