C20H13ClN4O5S — CID 39367831
N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-nitrobenzamide (PubChem CID 39367831) has the molecular formula C20H13ClN4O5S and a molecular weight of 456.87 g/mol. Its IUPAC name is N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 39367831 |
| Molecular Formula | C20H13ClN4O5S |
| Molecular Weight | 456.87 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-nitrobenzamide |
| SMILES | O=C(N/N=C/c1ccc(Sc2ccc(Cl)cc2)c([N+](=O)[O-])c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H13ClN4O5S/c21-15-4-8-17(9-5-15)31-19-10-1-13(11-18(19)25(29)30)12-22-23-20(26)14-2-6-16(7-3-14)24(27)28/h1-12H,(H,23,26)/b22-12+ |
| InChIKey | DWOXBWJXQJPSMN-WSDLNYQXSA-N |
| XLogP | 5.07 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.87 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|