C19H13ClN4O3S — CID 6112984
N-[(Z)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]pyridine-3-carboxamide (PubChem CID 6112984) has the molecular formula C19H13ClN4O3S and a molecular weight of 412.86 g/mol. Its IUPAC name is N-[(Z)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6112984 |
| Molecular Formula | C19H13ClN4O3S |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-[(Z)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Sc2ccc(Cl)cc2)c([N+](=O)[O-])c1)c1cccnc1 |
| InChI | InChI=1S/C19H13ClN4O3S/c20-15-4-6-16(7-5-15)28-18-8-3-13(10-17(18)24(26)27)11-22-23-19(25)14-2-1-9-21-12-14/h1-12H,(H,23,25)/b22-11- |
| InChIKey | OVASVWIYIMPOMY-JJFYIABZSA-N |
| XLogP | 4.56 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|