C20H13BrClN3O3S — CID 39367805
4-bromo-N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzamide (PubChem CID 39367805) has the molecular formula C20H13BrClN3O3S and a molecular weight of 490.77 g/mol. Its IUPAC name is 4-bromo-N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzamide.
| Compound Name | 4-bromo-N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 39367805 |
| Molecular Formula | C20H13BrClN3O3S |
| Molecular Weight | 490.77 g/mol |
| Exact Mass | 488.95 |
| IUPAC Name | 4-bromo-N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc(Sc2ccc(Cl)cc2)c([N+](=O)[O-])c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H13BrClN3O3S/c21-15-4-2-14(3-5-15)20(26)24-23-12-13-1-10-19(18(11-13)25(27)28)29-17-8-6-16(22)7-9-17/h1-12H,(H,24,26)/b23-12+ |
| InChIKey | WEMVEPIBLVSXRU-FSJBWODESA-N |
| XLogP | 5.93 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.77 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|