C19H12ClN5O6S — CID 98095612
N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline (PubChem CID 98095612) has the molecular formula C19H12ClN5O6S and a molecular weight of 473.85 g/mol. Its IUPAC name is N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 98095612 |
| Molecular Formula | C19H12ClN5O6S |
| Molecular Weight | 473.85 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | N-[(E)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2ccc(Sc3ccc(Cl)cc3)c([N+](=O)[O-])c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12ClN5O6S/c20-13-2-5-15(6-3-13)32-19-8-1-12(9-18(19)25(30)31)11-21-22-16-7-4-14(23(26)27)10-17(16)24(28)29/h1-11,22H/b21-11+ |
| InChIKey | CYSUBJDCGYJBGR-SRZZPIQSSA-N |
| XLogP | 5.66 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.85 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|