C16H12N8O6S — CID 126202342
N-[(Z)-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline (PubChem CID 126202342) has the molecular formula C16H12N8O6S and a molecular weight of 444.39 g/mol. Its IUPAC name is N-[(Z)-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 126202342 |
| Molecular Formula | C16H12N8O6S |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | N-[(Z)-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline |
| SMILES | Cc1nc(Sc2ccc(/C=N\Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C16H12N8O6S/c1-9-18-16(21-19-9)31-15-5-2-10(6-14(15)24(29)30)8-17-20-12-4-3-11(22(25)26)7-13(12)23(27)28/h2-8,20H,1H3,(H,18,19,21)/b17-8- |
| InChIKey | XCJBYPFOYGTUAE-IUXPMGMMSA-N |
| XLogP | 3.43 |
| TPSA | 195.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|