C11H9N5O4S — CID 9016165
N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-2,4-dinitroaniline (PubChem CID 9016165) has the molecular formula C11H9N5O4S and a molecular weight of 307.29 g/mol. Its IUPAC name is N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 9016165 |
| Molecular Formula | C11H9N5O4S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-2,4-dinitroaniline |
| SMILES | Cc1nc(/C=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C11H9N5O4S/c1-7-13-8(6-21-7)5-12-14-10-3-2-9(15(17)18)4-11(10)16(19)20/h2-6,14H,1H3/b12-5- |
| InChIKey | KZXLREWABIGIHN-XGICHPGQSA-N |
| XLogP | 2.71 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|