C12H10N6O6 — CID 135455298
5-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-hydroxy-2-methyl-1H-pyrimidin-6-one (PubChem CID 135455298) has the molecular formula C12H10N6O6 and a molecular weight of 334.25 g/mol. Its IUPAC name is 5-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-hydroxy-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-hydroxy-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135455298 |
| Molecular Formula | C12H10N6O6 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 5-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-hydroxy-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(O)c(/C=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C12H10N6O6/c1-6-14-11(19)8(12(20)15-6)5-13-16-9-3-2-7(17(21)22)4-10(9)18(23)24/h2-5,16H,1H3,(H2,14,15,19,20)/b13-5- |
| InChIKey | AKSXEKUPKDZQGA-ACAGNQJTSA-N |
| XLogP | 1.05 |
| TPSA | 176.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|