C15H12ClN5O7 — CID 136782887
4-chloro-2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-3,5-dimethyl-6-nitrophenol (PubChem CID 136782887) has the molecular formula C15H12ClN5O7 and a molecular weight of 409.74 g/mol. Its IUPAC name is 4-chloro-2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-3,5-dimethyl-6-nitrophenol.
| Compound Name | 4-chloro-2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-3,5-dimethyl-6-nitrophenol |
|---|---|
| PubChem CID | 136782887 |
| Molecular Formula | C15H12ClN5O7 |
| Molecular Weight | 409.74 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 4-chloro-2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-3,5-dimethyl-6-nitrophenol |
| SMILES | Cc1c(Cl)c(C)c([N+](=O)[O-])c(O)c1/C=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12ClN5O7/c1-7-10(15(22)14(21(27)28)8(2)13(7)16)6-17-18-11-4-3-9(19(23)24)5-12(11)20(25)26/h3-6,18,22H,1-2H3/b17-6- |
| InChIKey | CXHCDWSGRATWFS-FMQZQXMHSA-N |
| XLogP | 3.83 |
| TPSA | 174.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.74 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|