C14H12N4O5 — CID 137129355
2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-methylphenol (PubChem CID 137129355) has the molecular formula C14H12N4O5 and a molecular weight of 316.27 g/mol. Its IUPAC name is 2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-methylphenol.
| Compound Name | 2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 137129355 |
| Molecular Formula | C14H12N4O5 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(/C=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N4O5/c1-9-2-5-14(19)10(6-9)8-15-16-12-4-3-11(17(20)21)7-13(12)18(22)23/h2-8,16,19H,1H3/b15-8- |
| InChIKey | JKDYISLSSYOLAL-NVNXTCNLSA-N |
| XLogP | 2.96 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|