C17H19N5O5 — CID 135559916
5-(diethylamino)-2-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol (PubChem CID 135559916) has the molecular formula C17H19N5O5 and a molecular weight of 373.37 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 5-(diethylamino)-2-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135559916 |
| Molecular Formula | C17H19N5O5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 5-(diethylamino)-2-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol |
| SMILES | CCN(CC)c1ccc(/C=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C17H19N5O5/c1-3-20(4-2)13-6-5-12(17(23)10-13)11-18-19-15-8-7-14(21(24)25)9-16(15)22(26)27/h5-11,19,23H,3-4H2,1-2H3/b18-11+ |
| InChIKey | MXTPZPVHGMJYKM-WOJGMQOQSA-N |
| XLogP | 3.50 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|