C22H16N4O4 — CID 126009433
N-[(E)-(10-methylanthracen-9-yl)methylideneamino]-2,4-dinitroaniline (PubChem CID 126009433) has the molecular formula C22H16N4O4 and a molecular weight of 400.39 g/mol. Its IUPAC name is N-[(E)-(10-methylanthracen-9-yl)methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-(10-methylanthracen-9-yl)methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 126009433 |
| Molecular Formula | C22H16N4O4 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[(E)-(10-methylanthracen-9-yl)methylideneamino]-2,4-dinitroaniline |
| SMILES | Cc1c2ccccc2c(/C=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C22H16N4O4/c1-14-16-6-2-4-8-18(16)20(19-9-5-3-7-17(14)19)13-23-24-21-11-10-15(25(27)28)12-22(21)26(29)30/h2-13,24H,1H3/b23-13+ |
| InChIKey | WPFYKFYZFAFKQX-YDZHTSKRSA-N |
| XLogP | 5.56 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anthran_Z(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|