C22H17N5O5 — CID 137062422
N-[(E)-(7-methoxy-2-phenyl-1H-indol-3-yl)methylideneamino]-2,4-dinitroaniline (PubChem CID 137062422) has the molecular formula C22H17N5O5 and a molecular weight of 431.41 g/mol. Its IUPAC name is N-[(E)-(7-methoxy-2-phenyl-1H-indol-3-yl)methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-(7-methoxy-2-phenyl-1H-indol-3-yl)methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 137062422 |
| Molecular Formula | C22H17N5O5 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-[(E)-(7-methoxy-2-phenyl-1H-indol-3-yl)methylideneamino]-2,4-dinitroaniline |
| SMILES | COc1cccc2c(/C=N/Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(-c3ccccc3)[nH]c12 |
| InChI | InChI=1S/C22H17N5O5/c1-32-20-9-5-8-16-17(21(24-22(16)20)14-6-3-2-4-7-14)13-23-25-18-11-10-15(26(28)29)12-19(18)27(30)31/h2-13,24-25H,1H3/b23-13+ |
| InChIKey | KJYTVQZATFBEIM-YDZHTSKRSA-N |
| XLogP | 5.11 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|