C15H11N5O4 — CID 135411855
N-[(E)-1H-indol-3-ylmethylideneamino]-2,4-dinitroaniline (PubChem CID 135411855) has the molecular formula C15H11N5O4 and a molecular weight of 325.28 g/mol. Its IUPAC name is N-[(E)-1H-indol-3-ylmethylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-1H-indol-3-ylmethylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 135411855 |
| Molecular Formula | C15H11N5O4 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-[(E)-1H-indol-3-ylmethylideneamino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2c[nH]c3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11N5O4/c21-19(22)11-5-6-14(15(7-11)20(23)24)18-17-9-10-8-16-13-4-2-1-3-12(10)13/h1-9,16,18H/b17-9+ |
| InChIKey | MUTZZELKZCVYEZ-RQZCQDPDSA-N |
| XLogP | 3.43 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|