C21H16ClN5O4S — CID 135684654
N-(3-chlorophenyl)-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 135684654) has the molecular formula C21H16ClN5O4S and a molecular weight of 469.91 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(3-chlorophenyl)-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135684654 |
| Molecular Formula | C21H16ClN5O4S |
| Molecular Weight | 469.91 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | N-(3-chlorophenyl)-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2cccc(Cl)c2)ccc1N/N=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H16ClN5O4S/c22-15-4-3-5-16(10-15)26-32(30,31)17-8-9-20(21(11-17)27(28)29)25-24-13-14-12-23-19-7-2-1-6-18(14)19/h1-13,23,25-26H/b24-13+ |
| InChIKey | UBUYKCHDMPDBKF-ZMOGYAJESA-N |
| XLogP | 4.98 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.91 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|