C23H21N5O4S — CID 135679409
N-(2,4-dimethylphenyl)-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 135679409) has the molecular formula C23H21N5O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135679409 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(N/N=C/c3c[nH]c4ccccc34)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C23H21N5O4S/c1-15-7-9-20(16(2)11-15)27-33(31,32)18-8-10-22(23(12-18)28(29)30)26-25-14-17-13-24-21-6-4-3-5-19(17)21/h3-14,24,26-27H,1-2H3/b25-14+ |
| InChIKey | MQNBFLPPYMGREI-AFUMVMLFSA-N |
| XLogP | 4.94 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|