C24H26N4O7S — CID 4007800
N-(2,4-dimethylphenyl)-3-nitro-4-[2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 4007800) has the molecular formula C24H26N4O7S and a molecular weight of 514.56 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-nitro-4-[2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-nitro-4-[2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4007800 |
| Molecular Formula | C24H26N4O7S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-nitro-4-[2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | COc1cc(OC)c(OC)cc1C=NNc1ccc(S(=O)(=O)Nc2ccc(C)cc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H26N4O7S/c1-15-6-8-19(16(2)10-15)27-36(31,32)18-7-9-20(21(12-18)28(29)30)26-25-14-17-11-23(34-4)24(35-5)13-22(17)33-3/h6-14,26-27H,1-5H3 |
| InChIKey | KAMTUOBBDYXMFG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|