C21H18F2N4O4S — CID 16959862
4-[(2E)-2-[(3,4-difluorophenyl)methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-3-nitrobenzenesulfonamide (PubChem CID 16959862) has the molecular formula C21H18F2N4O4S and a molecular weight of 460.46 g/mol. Its IUPAC name is 4-[(2E)-2-[(3,4-difluorophenyl)methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2E)-2-[(3,4-difluorophenyl)methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 16959862 |
| Molecular Formula | C21H18F2N4O4S |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 4-[(2E)-2-[(3,4-difluorophenyl)methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(N/N=C/c3ccc(F)c(F)c3)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C21H18F2N4O4S/c1-13-3-7-19(14(2)9-13)26-32(30,31)16-5-8-20(21(11-16)27(28)29)25-24-12-15-4-6-17(22)18(23)10-15/h3-12,25-26H,1-2H3/b24-12+ |
| InChIKey | XVIVRKOBNJXZIK-WYMPLXKRSA-N |
| XLogP | 4.74 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|