C24H24N4O4S — CID 3394685
N-(2,4-dimethylphenyl)-4-[2-(2-methyl-3-phenylprop-2-enylidene)hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 3394685) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-[2-(2-methyl-3-phenylprop-2-enylidene)hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-[2-(2-methyl-3-phenylprop-2-enylidene)hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3394685 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-[2-(2-methyl-3-phenylprop-2-enylidene)hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | CC(C=NNc1ccc(S(=O)(=O)Nc2ccc(C)cc2C)cc1[N+](=O)[O-])=Cc1ccccc1 |
| InChI | InChI=1S/C24H24N4O4S/c1-17-9-11-22(19(3)13-17)27-33(31,32)21-10-12-23(24(15-21)28(29)30)26-25-16-18(2)14-20-7-5-4-6-8-20/h4-16,26-27H,1-3H3 |
| InChIKey | CPQTVALWWCLMSB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|