C28H21ClN6O4S — CID 75460493
N-(3-chlorophenyl)-4-[(2E)-2-[(1,3-diphenylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 75460493) has the molecular formula C28H21ClN6O4S and a molecular weight of 573.03 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[(2E)-2-[(1,3-diphenylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(3-chlorophenyl)-4-[(2E)-2-[(1,3-diphenylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 75460493 |
| Molecular Formula | C28H21ClN6O4S |
| Molecular Weight | 573.03 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | N-(3-chlorophenyl)-4-[(2E)-2-[(1,3-diphenylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2cccc(Cl)c2)ccc1N/N=C/c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H21ClN6O4S/c29-22-10-7-11-23(16-22)33-40(38,39)25-14-15-26(27(17-25)35(36)37)31-30-18-21-19-34(24-12-5-2-6-13-24)32-28(21)20-8-3-1-4-9-20/h1-19,31,33H/b30-18+ |
| InChIKey | OGSKRXHTGFMLRX-UXHLAJHPSA-N |
| XLogP | 6.35 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.03 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|