C14H10N4O6 — CID 5463188
2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]benzoic acid (PubChem CID 5463188) has the molecular formula C14H10N4O6 and a molecular weight of 330.26 g/mol. Its IUPAC name is 2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 5463188 |
| Molecular Formula | C14H10N4O6 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1/C=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10N4O6/c19-14(20)11-4-2-1-3-9(11)8-15-16-12-6-5-10(17(21)22)7-13(12)18(23)24/h1-8,16H,(H,19,20)/b15-8- |
| InChIKey | NJIWCXYRLFQRKD-NVNXTCNLSA-N |
| XLogP | 2.65 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|