C13H10N4O10S2 — CID 45039106
4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]benzene-1,3-disulfonic acid (PubChem CID 45039106) has the molecular formula C13H10N4O10S2 and a molecular weight of 446.38 g/mol. Its IUPAC name is 4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 45039106 |
| Molecular Formula | C13H10N4O10S2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | 4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]benzene-1,3-disulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N4O10S2/c18-16(19)9-2-4-11(12(5-9)17(20)21)15-14-7-8-1-3-10(28(22,23)24)6-13(8)29(25,26)27/h1-7,15H,(H,22,23,24)(H,25,26,27)/b14-7+ |
| InChIKey | WCKFIJPHKPHMMN-VGOFMYFVSA-N |
| XLogP | 1.44 |
| TPSA | 219.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|