C18H14N6O8 — CID 137074553
5-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-hydroxy-1-(2-methoxyphenyl)pyrimidine-2,4-dione (PubChem CID 137074553) has the molecular formula C18H14N6O8 and a molecular weight of 442.34 g/mol. Its IUPAC name is 5-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-hydroxy-1-(2-methoxyphenyl)pyrimidine-2,4-dione.
| Compound Name | 5-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-hydroxy-1-(2-methoxyphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137074553 |
| Molecular Formula | C18H14N6O8 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 5-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-hydroxy-1-(2-methoxyphenyl)pyrimidine-2,4-dione |
| SMILES | COc1ccccc1-n1c(O)c(C=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H14N6O8/c1-32-15-5-3-2-4-13(15)22-17(26)11(16(25)20-18(22)27)9-19-21-12-7-6-10(23(28)29)8-14(12)24(30)31/h2-9,21,26H,1H3,(H,20,25,27) |
| InChIKey | VXVQXMKTKOBVBS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 194.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|