C18H15N5O6 — CID 137073995
6-hydroxy-1-(4-methoxyphenyl)-5-[[(4-nitrophenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione (PubChem CID 137073995) has the molecular formula C18H15N5O6 and a molecular weight of 397.35 g/mol. Its IUPAC name is 6-hydroxy-1-(4-methoxyphenyl)-5-[[(4-nitrophenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-(4-methoxyphenyl)-5-[[(4-nitrophenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137073995 |
| Molecular Formula | C18H15N5O6 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 6-hydroxy-1-(4-methoxyphenyl)-5-[[(4-nitrophenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(-n2c(O)c(C=NNc3ccc([N+](=O)[O-])cc3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H15N5O6/c1-29-14-8-6-12(7-9-14)22-17(25)15(16(24)20-18(22)26)10-19-21-11-2-4-13(5-3-11)23(27)28/h2-10,21,25H,1H3,(H,20,24,26) |
| InChIKey | UHLAFULMOKDPGL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|