C18H14N4O6 — CID 2879727
6-hydroxy-5-[(4-methoxy-2-nitrophenyl)iminomethyl]-1-phenylpyrimidine-2,4-dione (PubChem CID 2879727) has the molecular formula C18H14N4O6 and a molecular weight of 382.33 g/mol. Its IUPAC name is 6-hydroxy-5-[(4-methoxy-2-nitrophenyl)iminomethyl]-1-phenylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(4-methoxy-2-nitrophenyl)iminomethyl]-1-phenylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2879727 |
| Molecular Formula | C18H14N4O6 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 6-hydroxy-5-[(4-methoxy-2-nitrophenyl)iminomethyl]-1-phenylpyrimidine-2,4-dione |
| SMILES | COc1ccc(/N=C/c2c(O)n(-c3ccccc3)c(=O)[nH]c2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N4O6/c1-28-12-7-8-14(15(9-12)22(26)27)19-10-13-16(23)20-18(25)21(17(13)24)11-5-3-2-4-6-11/h2-10,24H,1H3,(H,20,23,25)/b19-10+ |
| InChIKey | OQSUOHQDYVBCQV-VXLYETTFSA-N |
| XLogP | 1.90 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|