C18H13N5O5 — CID 135652672
5-(2,1,3-benzoxadiazol-4-yliminomethyl)-6-hydroxy-1-(3-methoxyphenyl)pyrimidine-2,4-dione (PubChem CID 135652672) has the molecular formula C18H13N5O5 and a molecular weight of 379.33 g/mol. Its IUPAC name is 5-(2,1,3-benzoxadiazol-4-yliminomethyl)-6-hydroxy-1-(3-methoxyphenyl)pyrimidine-2,4-dione.
| Compound Name | 5-(2,1,3-benzoxadiazol-4-yliminomethyl)-6-hydroxy-1-(3-methoxyphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135652672 |
| Molecular Formula | C18H13N5O5 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 5-(2,1,3-benzoxadiazol-4-yliminomethyl)-6-hydroxy-1-(3-methoxyphenyl)pyrimidine-2,4-dione |
| SMILES | COc1cccc(-n2c(O)c(/C=N/c3cccc4nonc34)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C18H13N5O5/c1-27-11-5-2-4-10(8-11)23-17(25)12(16(24)20-18(23)26)9-19-13-6-3-7-14-15(13)22-28-21-14/h2-9,25H,1H3,(H,20,24,26)/b19-9+ |
| InChIKey | HTIMCQIIOKETLJ-DJKKODMXSA-N |
| XLogP | 1.53 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|