C18H11ClN3O5- — CID 135830794
2-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate (PubChem CID 135830794) has the molecular formula C18H11ClN3O5- and a molecular weight of 384.76 g/mol. Its IUPAC name is 2-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate.
| Compound Name | 2-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 135830794 |
| Molecular Formula | C18H11ClN3O5- |
| Molecular Weight | 384.76 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate |
| SMILES | O=C([O-])c1ccccc1/N=C/c1c(O)n(-c2cccc(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H12ClN3O5/c19-10-4-3-5-11(8-10)22-16(24)13(15(23)21-18(22)27)9-20-14-7-2-1-6-12(14)17(25)26/h1-9,24H,(H,25,26)(H,21,23,27)/p-1/b20-9+ |
| InChIKey | SQMXYIKKZHMASY-AWQFTUOYSA-M |
| XLogP | 1.00 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.76 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|