C19H12ClN5O3S — CID 3119701
1-(3-chlorophenyl)-6-hydroxy-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 3119701) has the molecular formula C19H12ClN5O3S and a molecular weight of 425.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-6-hydroxy-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(3-chlorophenyl)-6-hydroxy-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3119701 |
| Molecular Formula | C19H12ClN5O3S |
| Molecular Weight | 425.86 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 1-(3-chlorophenyl)-6-hydroxy-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2cccc(Cl)c2)c(O)c1C=Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C19H12ClN5O3S/c20-12-7-4-8-13(9-12)25-17(27)14(15(26)22-19(25)28)10-21-18-24-23-16(29-18)11-5-2-1-3-6-11/h1-10,27H,(H,22,26,28) |
| InChIKey | BVQRPUGTMWTSJM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.86 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|