C17H13ClN4O5S — CID 3119695
4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzenesulfonamide (PubChem CID 3119695) has the molecular formula C17H13ClN4O5S and a molecular weight of 420.83 g/mol. Its IUPAC name is 4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 3119695 |
| Molecular Formula | C17H13ClN4O5S |
| Molecular Weight | 420.83 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=C/c2c(O)n(-c3cccc(Cl)c3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H13ClN4O5S/c18-10-2-1-3-12(8-10)22-16(24)14(15(23)21-17(22)25)9-20-11-4-6-13(7-5-11)28(19,26)27/h1-9,24H,(H2,19,26,27)(H,21,23,25)/b20-9+ |
| InChIKey | PDCLXXFHICJBHV-AWQFTUOYSA-N |
| XLogP | 1.28 |
| TPSA | 147.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.83 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|