C18H10Cl2N4O3S — CID 135628411
[2-chloro-4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl] thiocyanate (PubChem CID 135628411) has the molecular formula C18H10Cl2N4O3S and a molecular weight of 433.28 g/mol. Its IUPAC name is [2-chloro-4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl] thiocyanate.
| Compound Name | [2-chloro-4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 135628411 |
| Molecular Formula | C18H10Cl2N4O3S |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | [2-chloro-4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(/N=C/c2c(O)n(-c3cccc(Cl)c3)c(=O)[nH]c2=O)cc1Cl |
| InChI | InChI=1S/C18H10Cl2N4O3S/c19-10-2-1-3-12(6-10)24-17(26)13(16(25)23-18(24)27)8-22-11-4-5-15(28-9-21)14(20)7-11/h1-8,26H,(H,23,25,27)/b22-8+ |
| InChIKey | XNYZXPWUYPMTHA-GZIVZEMBSA-N |
| XLogP | 3.86 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|