C22H19ClN4O5 — CID 135628500
1-(3-chlorophenyl)-6-hydroxy-5-[[4-(morpholine-4-carbonyl)phenyl]iminomethyl]pyrimidine-2,4-dione (PubChem CID 135628500) has the molecular formula C22H19ClN4O5 and a molecular weight of 454.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-6-hydroxy-5-[[4-(morpholine-4-carbonyl)phenyl]iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(3-chlorophenyl)-6-hydroxy-5-[[4-(morpholine-4-carbonyl)phenyl]iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135628500 |
| Molecular Formula | C22H19ClN4O5 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 1-(3-chlorophenyl)-6-hydroxy-5-[[4-(morpholine-4-carbonyl)phenyl]iminomethyl]pyrimidine-2,4-dione |
| SMILES | O=C(c1ccc(/N=C/c2c(O)n(-c3cccc(Cl)c3)c(=O)[nH]c2=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H19ClN4O5/c23-15-2-1-3-17(12-15)27-21(30)18(19(28)25-22(27)31)13-24-16-6-4-14(5-7-16)20(29)26-8-10-32-11-9-26/h1-7,12-13,30H,8-11H2,(H,25,28,31)/b24-13+ |
| InChIKey | SWLCRENFTHLNKU-ZMOGYAJESA-N |
| XLogP | 2.11 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|