C24H23BrN4O5 — CID 137074559
1-(4-bromo-2-ethylphenyl)-6-hydroxy-5-[[4-(morpholine-4-carbonyl)phenyl]iminomethyl]pyrimidine-2,4-dione (PubChem CID 137074559) has the molecular formula C24H23BrN4O5 and a molecular weight of 527.38 g/mol. Its IUPAC name is 1-(4-bromo-2-ethylphenyl)-6-hydroxy-5-[[4-(morpholine-4-carbonyl)phenyl]iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-bromo-2-ethylphenyl)-6-hydroxy-5-[[4-(morpholine-4-carbonyl)phenyl]iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137074559 |
| Molecular Formula | C24H23BrN4O5 |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 1-(4-bromo-2-ethylphenyl)-6-hydroxy-5-[[4-(morpholine-4-carbonyl)phenyl]iminomethyl]pyrimidine-2,4-dione |
| SMILES | CCc1cc(Br)ccc1-n1c(O)c(/C=N/c2ccc(C(=O)N3CCOCC3)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H23BrN4O5/c1-2-15-13-17(25)5-8-20(15)29-23(32)19(21(30)27-24(29)33)14-26-18-6-3-16(4-7-18)22(31)28-9-11-34-12-10-28/h3-8,13-14,32H,2,9-12H2,1H3,(H,27,30,33)/b26-14+ |
| InChIKey | QWJSQXCSLCYKMU-VULFUBBASA-N |
| XLogP | 2.78 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|