C24H25BrN4O5S — CID 137074733
1-(4-bromo-2-ethylphenyl)-6-hydroxy-5-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 137074733) has the molecular formula C24H25BrN4O5S and a molecular weight of 561.46 g/mol. Its IUPAC name is 1-(4-bromo-2-ethylphenyl)-6-hydroxy-5-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-bromo-2-ethylphenyl)-6-hydroxy-5-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137074733 |
| Molecular Formula | C24H25BrN4O5S |
| Molecular Weight | 561.46 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | 1-(4-bromo-2-ethylphenyl)-6-hydroxy-5-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | CCc1cc(Br)ccc1-n1c(O)c(/C=N/c2ccc(S(=O)(=O)N3CCCCC3)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H25BrN4O5S/c1-2-16-14-17(25)6-11-21(16)29-23(31)20(22(30)27-24(29)32)15-26-18-7-9-19(10-8-18)35(33,34)28-12-4-3-5-13-28/h6-11,14-15,31H,2-5,12-13H2,1H3,(H,27,30,32)/b26-15+ |
| InChIKey | SBXGVOMRYIQNNA-CVKSISIWSA-N |
| XLogP | 3.48 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|