C21H18BrN3O5 — CID 137074723
3-[[1-(4-bromo-2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methylbenzoic acid (PubChem CID 137074723) has the molecular formula C21H18BrN3O5 and a molecular weight of 472.30 g/mol. Its IUPAC name is 3-[[1-(4-bromo-2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methylbenzoic acid.
| Compound Name | 3-[[1-(4-bromo-2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 137074723 |
| Molecular Formula | C21H18BrN3O5 |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 3-[[1-(4-bromo-2-ethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methylbenzoic acid |
| SMILES | CCc1cc(Br)ccc1-n1c(O)c(/C=N/c2cc(C(=O)O)ccc2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H18BrN3O5/c1-3-12-8-14(22)6-7-17(12)25-19(27)15(18(26)24-21(25)30)10-23-16-9-13(20(28)29)5-4-11(16)2/h4-10,27H,3H2,1-2H3,(H,28,29)(H,24,26,30)/b23-10+ |
| InChIKey | PLLYEBSUCYHWLA-AUEPDCJTSA-N |
| XLogP | 3.31 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|