C20H16BrN3O6 — CID 137073754
4-[[1-(4-bromo-2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-hydroxybenzoic acid (PubChem CID 137073754) has the molecular formula C20H16BrN3O6 and a molecular weight of 474.27 g/mol. Its IUPAC name is 4-[[1-(4-bromo-2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[1-(4-bromo-2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 137073754 |
| Molecular Formula | C20H16BrN3O6 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 4-[[1-(4-bromo-2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-hydroxybenzoic acid |
| SMILES | Cc1c(Br)ccc(-n2c(O)c(/C=N/c3ccc(C(=O)O)c(O)c3)c(=O)[nH]c2=O)c1C |
| InChI | InChI=1S/C20H16BrN3O6/c1-9-10(2)15(6-5-14(9)21)24-18(27)13(17(26)23-20(24)30)8-22-11-3-4-12(19(28)29)16(25)7-11/h3-8,25,27H,1-2H3,(H,28,29)(H,23,26,30)/b22-8+ |
| InChIKey | VOHYKIYZTXKNNX-GZIVZEMBSA-N |
| XLogP | 2.77 |
| TPSA | 144.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|