C21H18BrN5O6 — CID 137074960
N-[[1-(4-bromo-2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methyl-3-nitrobenzamide (PubChem CID 137074960) has the molecular formula C21H18BrN5O6 and a molecular weight of 516.31 g/mol. Its IUPAC name is N-[[1-(4-bromo-2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[[1-(4-bromo-2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 137074960 |
| Molecular Formula | C21H18BrN5O6 |
| Molecular Weight | 516.31 g/mol |
| Exact Mass | 515.04 |
| IUPAC Name | N-[[1-(4-bromo-2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)NN=Cc2c(O)n(-c3ccc(Br)c(C)c3C)c(=O)[nH]c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H18BrN5O6/c1-10-4-5-13(8-17(10)27(32)33)18(28)25-23-9-14-19(29)24-21(31)26(20(14)30)16-7-6-15(22)11(2)12(16)3/h4-9,30H,1-3H3,(H,25,28)(H,24,29,31) |
| InChIKey | WCVXPBDJPRXOKL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|