C20H17BrClN3O3 — CID 137070839
1-(4-bromo-2,3-dimethylphenyl)-5-[(3-chloro-4-methylphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 137070839) has the molecular formula C20H17BrClN3O3 and a molecular weight of 462.73 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dimethylphenyl)-5-[(3-chloro-4-methylphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(4-bromo-2,3-dimethylphenyl)-5-[(3-chloro-4-methylphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137070839 |
| Molecular Formula | C20H17BrClN3O3 |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | 1-(4-bromo-2,3-dimethylphenyl)-5-[(3-chloro-4-methylphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | Cc1ccc(/N=C/c2c(O)n(-c3ccc(Br)c(C)c3C)c(=O)[nH]c2=O)cc1Cl |
| InChI | InChI=1S/C20H17BrClN3O3/c1-10-4-5-13(8-16(10)22)23-9-14-18(26)24-20(28)25(19(14)27)17-7-6-15(21)11(2)12(17)3/h4-9,27H,1-3H3,(H,24,26,28)/b23-9+ |
| InChIKey | ZJCKWSBYEXRQDP-NUGSKGIGSA-N |
| XLogP | 4.32 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|