C21H20BrN3O3 — CID 137070493
5-[(4-bromo-3-methylphenyl)iminomethyl]-6-hydroxy-1-(2,4,6-trimethylphenyl)pyrimidine-2,4-dione (PubChem CID 137070493) has the molecular formula C21H20BrN3O3 and a molecular weight of 442.31 g/mol. Its IUPAC name is 5-[(4-bromo-3-methylphenyl)iminomethyl]-6-hydroxy-1-(2,4,6-trimethylphenyl)pyrimidine-2,4-dione.
| Compound Name | 5-[(4-bromo-3-methylphenyl)iminomethyl]-6-hydroxy-1-(2,4,6-trimethylphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137070493 |
| Molecular Formula | C21H20BrN3O3 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 5-[(4-bromo-3-methylphenyl)iminomethyl]-6-hydroxy-1-(2,4,6-trimethylphenyl)pyrimidine-2,4-dione |
| SMILES | Cc1cc(C)c(-n2c(O)c(/C=N/c3ccc(Br)c(C)c3)c(=O)[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C21H20BrN3O3/c1-11-7-13(3)18(14(4)8-11)25-20(27)16(19(26)24-21(25)28)10-23-15-5-6-17(22)12(2)9-15/h5-10,27H,1-4H3,(H,24,26,28)/b23-10+ |
| InChIKey | CIDICAXTBRBFND-AUEPDCJTSA-N |
| XLogP | 3.98 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|