C19H12BrN5O5S — CID 4672410
[4-[[1-(4-bromo-3-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-nitrophenyl] thiocyanate (PubChem CID 4672410) has the molecular formula C19H12BrN5O5S and a molecular weight of 502.31 g/mol. Its IUPAC name is [4-[[1-(4-bromo-3-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-nitrophenyl] thiocyanate.
| Compound Name | [4-[[1-(4-bromo-3-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-nitrophenyl] thiocyanate |
|---|---|
| PubChem CID | 4672410 |
| Molecular Formula | C19H12BrN5O5S |
| Molecular Weight | 502.31 g/mol |
| Exact Mass | 500.97 |
| IUPAC Name | [4-[[1-(4-bromo-3-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-2-nitrophenyl] thiocyanate |
| SMILES | Cc1cc(-n2c(O)c(/C=N/c3ccc(SC#N)c([N+](=O)[O-])c3)c(=O)[nH]c2=O)ccc1Br |
| InChI | InChI=1S/C19H12BrN5O5S/c1-10-6-12(3-4-14(10)20)24-18(27)13(17(26)23-19(24)28)8-22-11-2-5-16(31-9-21)15(7-11)25(29)30/h2-8,27H,1H3,(H,23,26,28)/b22-8+ |
| InChIKey | CUBZBMQXZGCCNV-GZIVZEMBSA-N |
| XLogP | 3.53 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|